C22H20Br2N4O2 — CID 139171111
1-(4-bromo-3-methylphenyl)-3-[3-[(4-bromo-3-methylphenyl)carbamoylamino]phenyl]urea (PubChem CID 139171111) has the molecular formula C22H20Br2N4O2 and a molecular weight of 532.24 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[3-[(4-bromo-3-methylphenyl)carbamoylamino]phenyl]urea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[3-[(4-bromo-3-methylphenyl)carbamoylamino]phenyl]urea |
|---|---|
| PubChem CID | 139171111 |
| Molecular Formula | C22H20Br2N4O2 |
| Molecular Weight | 532.24 g/mol |
| Exact Mass | 530.00 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[3-[(4-bromo-3-methylphenyl)carbamoylamino]phenyl]urea |
| SMILES | Cc1cc(NC(=O)Nc2cccc(NC(=O)Nc3ccc(Br)c(C)c3)c2)ccc1Br |
| InChI | InChI=1S/C22H20Br2N4O2/c1-13-10-17(6-8-19(13)23)27-21(29)25-15-4-3-5-16(12-15)26-22(30)28-18-7-9-20(24)14(2)11-18/h3-12H,1-2H3,(H2,25,27,29)(H2,26,28,30) |
| InChIKey | FHGYBWUZPLVPFY-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.24 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |