C32H36BCl4N3P2 — CID 139171161
bis(dichloromethane);(1-diphenylphosphanyl-2,3,4,6,7,8-hexahydro-[1,3,2]diazaborinino[1,2-a][1,3,2]diazaborinin-9-yl)-diphenylphosphane (PubChem CID 139171161) has the molecular formula C32H36BCl4N3P2 and a molecular weight of 677.23 g/mol. Its IUPAC name is bis(dichloromethane);(1-diphenylphosphanyl-2,3,4,6,7,8-hexahydro-[1,3,2]diazaborinino[1,2-a][1,3,2]diazaborinin-9-yl)-diphenylphosphane.
| Compound Name | bis(dichloromethane);(1-diphenylphosphanyl-2,3,4,6,7,8-hexahydro-[1,3,2]diazaborinino[1,2-a][1,3,2]diazaborinin-9-yl)-diphenylphosphane |
|---|---|
| PubChem CID | 139171161 |
| Molecular Formula | C32H36BCl4N3P2 |
| Molecular Weight | 677.23 g/mol |
| Exact Mass | 675.12 |
| IUPAC Name | bis(dichloromethane);(1-diphenylphosphanyl-2,3,4,6,7,8-hexahydro-[1,3,2]diazaborinino[1,2-a][1,3,2]diazaborinin-9-yl)-diphenylphosphane |
| SMILES | ClCCl.ClCCl.c1ccc(P(c2ccccc2)N2CCCN3CCCN(P(c4ccccc4)c4ccccc4)B32)cc1 |
| InChI | InChI=1S/C30H32BN3P2.2CH2Cl2/c1-5-15-27(16-6-1)35(28-17-7-2-8-18-28)33-25-13-23-32-24-14-26-34(31(32)33)36(29-19-9-3-10-20-29)30-21-11-4-12-22-30;2*2-1-3/h1-12,15-22H,13-14,23-26H2;2*1H2 |
| InChIKey | LXXBTESJLVGDMT-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.23 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|