C23H15BF2N2S4 — CID 139171853
2,2-difluoro-8-phenyl-4,12-bis(thiophen-2-ylsulfanyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139171853) has the molecular formula C23H15BF2N2S4 and a molecular weight of 496.46 g/mol. Its IUPAC name is 2,2-difluoro-8-phenyl-4,12-bis(thiophen-2-ylsulfanyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-8-phenyl-4,12-bis(thiophen-2-ylsulfanyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139171853 |
| Molecular Formula | C23H15BF2N2S4 |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | 2,2-difluoro-8-phenyl-4,12-bis(thiophen-2-ylsulfanyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | F[B-]1(F)n2c(Sc3cccs3)ccc2C(c2ccccc2)=C2C=CC(Sc3cccs3)=[N+]21 |
| InChI | InChI=1S/C23H15BF2N2S4/c25-24(26)27-17(10-12-19(27)31-21-8-4-14-29-21)23(16-6-2-1-3-7-16)18-11-13-20(28(18)24)32-22-9-5-15-30-22/h1-15H |
| InChIKey | QZGBXFXXGIBULV-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|