C34H38F9N2O6Pr — CID 139172087
praseodymium(3+);2-pyridin-2-ylpyridine;tris((Z)-1,1,1-trifluoro-5,5-dimethyl-4-oxohex-2-en-2-olate) (PubChem CID 139172087) has the molecular formula C34H38F9N2O6Pr and a molecular weight of 882.58 g/mol. Its IUPAC name is praseodymium(3+);2-pyridin-2-ylpyridine;tris((Z)-1,1,1-trifluoro-5,5-dimethyl-4-oxohex-2-en-2-olate).
| Compound Name | praseodymium(3+);2-pyridin-2-ylpyridine;tris((Z)-1,1,1-trifluoro-5,5-dimethyl-4-oxohex-2-en-2-olate) |
|---|---|
| PubChem CID | 139172087 |
| Molecular Formula | C34H38F9N2O6Pr |
| Molecular Weight | 882.58 g/mol |
| Exact Mass | 882.17 |
| IUPAC Name | praseodymium(3+);2-pyridin-2-ylpyridine;tris((Z)-1,1,1-trifluoro-5,5-dimethyl-4-oxohex-2-en-2-olate) |
| SMILES | CC(C)(C)C(=O)/C=C(\[O-])C(F)(F)F.CC(C)(C)C(=O)/C=C(\[O-])C(F)(F)F.CC(C)(C)C(=O)/C=C(\[O-])C(F)(F)F.[Pr+3].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.3C8H11F3O2.Pr/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;3*1-7(2,3)5(12)4-6(13)8(9,10)11;/h1-8H;3*4,13H,1-3H3;/q;;;;+3/p-3/b;3*6-4-; |
| InChIKey | SZYIVLVVPHBCSN-XRPAYOKVSA-K |
| XLogP | 6.37 |
| TPSA | 146.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|