C40H43BF5OP — CID 139172375
(1S,5S,9R)-9-methyl-1-(2,3,4,5,6-pentafluorophenyl)-3,5-diphenyl-6-[2,4,6-tri(propan-2-yl)phenyl]-2-oxa-6-phosphonia-1-boranuidabicyclo[4.2.1]non-3-ene (PubChem CID 139172375) has the molecular formula C40H43BF5OP and a molecular weight of 676.56 g/mol. Its IUPAC name is (1S,5S,9R)-9-methyl-1-(2,3,4,5,6-pentafluorophenyl)-3,5-diphenyl-6-[2,4,6-tri(propan-2-yl)phenyl]-2-oxa-6-phosphonia-1-boranuidabicyclo[4.2.1]non-3-ene.
| Compound Name | (1S,5S,9R)-9-methyl-1-(2,3,4,5,6-pentafluorophenyl)-3,5-diphenyl-6-[2,4,6-tri(propan-2-yl)phenyl]-2-oxa-6-phosphonia-1-boranuidabicyclo[4.2.1]non-3-ene |
|---|---|
| PubChem CID | 139172375 |
| Molecular Formula | C40H43BF5OP |
| Molecular Weight | 676.56 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | (1S,5S,9R)-9-methyl-1-(2,3,4,5,6-pentafluorophenyl)-3,5-diphenyl-6-[2,4,6-tri(propan-2-yl)phenyl]-2-oxa-6-phosphonia-1-boranuidabicyclo[4.2.1]non-3-ene |
| SMILES | CC(C)c1cc(C(C)C)c([P+]23CC[B@@-](c4c(F)c(F)c(F)c(F)c4F)(OC(c4ccccc4)=C[C@H]2c2ccccc2)[C@@H]3C)c(C(C)C)c1 |
| InChI | InChI=1S/C40H43BF5OP/c1-23(2)29-20-30(24(3)4)40(31(21-29)25(5)6)48-19-18-41(26(48)7,34-35(42)37(44)39(46)38(45)36(34)43)47-32(27-14-10-8-11-15-27)22-33(48)28-16-12-9-13-17-28/h8-17,20-26,33H,18-19H2,1-7H3/t26-,33-,41+,48?/m0/s1 |
| InChIKey | OMSOZXRMYDIXDT-USZUIVANSA-N |
| XLogP | 11.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.56 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|