C20H31N5O — CID 139172414
6-[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-2,4-di(propan-2-yl)-1,2,4,5-tetrazinan-3-one (PubChem CID 139172414) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is 6-[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-2,4-di(propan-2-yl)-1,2,4,5-tetrazinan-3-one.
| Compound Name | 6-[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-2,4-di(propan-2-yl)-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 139172414 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 6-[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-2,4-di(propan-2-yl)-1,2,4,5-tetrazinan-3-one |
| SMILES | CC(C)N1NC(c2cc3c(cn2)[C@@H]2C[C@H](C3)C2(C)C)NN(C(C)C)C1=O |
| InChI | InChI=1S/C20H31N5O/c1-11(2)24-19(26)25(12(3)4)23-18(22-24)17-8-13-7-14-9-16(20(14,5)6)15(13)10-21-17/h8,10-12,14,16,18,22-23H,7,9H2,1-6H3/t14-,16-/m0/s1 |
| InChIKey | AMHAYLDHGWFRJW-HOCLYGCPSA-N |
| XLogP | 3.33 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |