C44H32NOP — CID 139172661
4-[(1S)-1-oxo-1,2,3-triphenylphosphindol-7-yl]-N,N-diphenylaniline (PubChem CID 139172661) has the molecular formula C44H32NOP and a molecular weight of 621.72 g/mol. Its IUPAC name is 4-[(1S)-1-oxo-1,2,3-triphenylphosphindol-7-yl]-N,N-diphenylaniline.
| Compound Name | 4-[(1S)-1-oxo-1,2,3-triphenylphosphindol-7-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 139172661 |
| Molecular Formula | C44H32NOP |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | 4-[(1S)-1-oxo-1,2,3-triphenylphosphindol-7-yl]-N,N-diphenylaniline |
| SMILES | O=[P@]1(c2ccccc2)C(c2ccccc2)=C(c2ccccc2)c2cccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c21 |
| InChI | InChI=1S/C44H32NOP/c46-47(39-25-14-5-15-26-39)43(35-19-8-2-9-20-35)42(34-17-6-1-7-18-34)41-28-16-27-40(44(41)47)33-29-31-38(32-30-33)45(36-21-10-3-11-22-36)37-23-12-4-13-24-37/h1-32H/t47-/m1/s1 |
| InChIKey | ZVJYRSUBGIYVQW-QZNUWAOFSA-N |
| XLogP | 11.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|