C48H44B2F20N2 — CID 139173015
bis(2,3,4,5,6-pentafluorophenyl)-[(Z)-1-(2,2,6,6-tetramethylpiperidin-1-yl)prop-1-en-2-yl]borane (PubChem CID 139173015) has the molecular formula C48H44B2F20N2 and a molecular weight of 1050.48 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-[(Z)-1-(2,2,6,6-tetramethylpiperidin-1-yl)prop-1-en-2-yl]borane.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-[(Z)-1-(2,2,6,6-tetramethylpiperidin-1-yl)prop-1-en-2-yl]borane |
|---|---|
| PubChem CID | 139173015 |
| Molecular Formula | C48H44B2F20N2 |
| Molecular Weight | 1050.48 g/mol |
| Exact Mass | 1050.34 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-[(Z)-1-(2,2,6,6-tetramethylpiperidin-1-yl)prop-1-en-2-yl]borane |
| SMILES | C/C(=C\N1C(C)(C)CCCC1(C)C)B(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F.C/C(=C\N1C(C)(C)CCCC1(C)C)B(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/2C24H22BF10N/c2*1-10(9-36-23(2,3)7-6-8-24(36,4)5)25(11-13(26)17(30)21(34)18(31)14(11)27)12-15(28)19(32)22(35)20(33)16(12)29/h2*9H,6-8H2,1-5H3/b2*10-9+ |
| InChIKey | NIETWTFEPBSAAF-FJEDDJBMSA-N |
| XLogP | 12.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1050.48 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|