C26H20BNO4 — CID 139173454
4-(4-methoxyphenyl)-5-phenylspiro[3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] (PubChem CID 139173454) has the molecular formula C26H20BNO4 and a molecular weight of 421.26 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-5-phenylspiro[3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene].
| Compound Name | 4-(4-methoxyphenyl)-5-phenylspiro[3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
|---|---|
| PubChem CID | 139173454 |
| Molecular Formula | C26H20BNO4 |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-(4-methoxyphenyl)-5-phenylspiro[3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
| SMILES | COc1ccc(C2=C(c3ccccc3)c3cccc[n+]3[B-]3(O2)Oc2ccccc2O3)cc1 |
| InChI | InChI=1S/C26H20BNO4/c1-29-21-16-14-20(15-17-21)26-25(19-9-3-2-4-10-19)22-11-7-8-18-28(22)27(32-26)30-23-12-5-6-13-24(23)31-27/h2-18H,1H3 |
| InChIKey | NLCFOTCAIDPQHL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|