C27H17BF10N2O2 — CID 139173949
[4-(dimethylamino)pyridin-1-ium-1-yl]-(4-methylbenzoyl)oxy-bis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139173949) has the molecular formula C27H17BF10N2O2 and a molecular weight of 602.24 g/mol. Its IUPAC name is [4-(dimethylamino)pyridin-1-ium-1-yl]-(4-methylbenzoyl)oxy-bis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [4-(dimethylamino)pyridin-1-ium-1-yl]-(4-methylbenzoyl)oxy-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139173949 |
| Molecular Formula | C27H17BF10N2O2 |
| Molecular Weight | 602.24 g/mol |
| Exact Mass | 602.12 |
| IUPAC Name | [4-(dimethylamino)pyridin-1-ium-1-yl]-(4-methylbenzoyl)oxy-bis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Cc1ccc(C(=O)O[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)[n+]2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H17BF10N2O2/c1-12-4-6-13(7-5-12)27(41)42-28(40-10-8-14(9-11-40)39(2)3,15-17(29)21(33)25(37)22(34)18(15)30)16-19(31)23(35)26(38)24(36)20(16)32/h4-11H,1-3H3 |
| InChIKey | CLEKLQLFWXVLSS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|