C12H8F5N3O2 — CID 139174134
ethyl 3-[(2,3,4,5,6-pentafluorophenyl)methyl]triazole-4-carboxylate (PubChem CID 139174134) has the molecular formula C12H8F5N3O2 and a molecular weight of 321.21 g/mol. Its IUPAC name is ethyl 3-[(2,3,4,5,6-pentafluorophenyl)methyl]triazole-4-carboxylate.
| Compound Name | ethyl 3-[(2,3,4,5,6-pentafluorophenyl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 139174134 |
| Molecular Formula | C12H8F5N3O2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | ethyl 3-[(2,3,4,5,6-pentafluorophenyl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnnn1Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H8F5N3O2/c1-2-22-12(21)6-3-18-19-20(6)4-5-7(13)9(15)11(17)10(16)8(5)14/h3H,2,4H2,1H3 |
| InChIKey | BCEVNMCGRMLPKA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|