C24H24FNO2 — CID 139174295
4-fluoro-2-[[(2S)-1-hydroxy-3-methyl-1,1-diphenylbutan-2-yl]iminomethyl]phenol (PubChem CID 139174295) has the molecular formula C24H24FNO2 and a molecular weight of 377.46 g/mol. Its IUPAC name is 4-fluoro-2-[[(2S)-1-hydroxy-3-methyl-1,1-diphenylbutan-2-yl]iminomethyl]phenol.
| Compound Name | 4-fluoro-2-[[(2S)-1-hydroxy-3-methyl-1,1-diphenylbutan-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 139174295 |
| Molecular Formula | C24H24FNO2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 4-fluoro-2-[[(2S)-1-hydroxy-3-methyl-1,1-diphenylbutan-2-yl]iminomethyl]phenol |
| SMILES | CC(C)[C@H](/N=C/c1cc(F)ccc1O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24FNO2/c1-17(2)23(26-16-18-15-21(25)13-14-22(18)27)24(28,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-17,23,27-28H,1-2H3/b26-16+/t23-/m0/s1 |
| InChIKey | DZHZTJXBXRUMCG-LRULAXNGSA-N |
| XLogP | 4.91 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|