C24H20BF10NSi — CID 139174430
methyl-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilylprop-1-enyl]-pyridin-1-ium-1-ylboranuide (PubChem CID 139174430) has the molecular formula C24H20BF10NSi and a molecular weight of 551.31 g/mol. Its IUPAC name is methyl-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilylprop-1-enyl]-pyridin-1-ium-1-ylboranuide.
| Compound Name | methyl-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilylprop-1-enyl]-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139174430 |
| Molecular Formula | C24H20BF10NSi |
| Molecular Weight | 551.31 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | methyl-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilylprop-1-enyl]-pyridin-1-ium-1-ylboranuide |
| SMILES | C/C(=C(\c1c(F)c(F)c(F)c(F)c1F)[B@@-](C)(c1c(F)c(F)c(F)c(F)c1F)[n+]1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C24H20BF10NSi/c1-11(37(3,4)5)13(12-15(26)19(30)23(34)20(31)16(12)27)25(2,36-9-7-6-8-10-36)14-17(28)21(32)24(35)22(33)18(14)29/h6-10H,1-5H3/b13-11-/t25-/m0/s1 |
| InChIKey | NQFPESLAGDIDCV-RCZVZRIZSA-N |
| XLogP | 6.59 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.31 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|