C23H17BClF10NSi — CID 139174432
chloro-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilylprop-1-enyl]-pyridin-1-ium-1-ylboranuide (PubChem CID 139174432) has the molecular formula C23H17BClF10NSi and a molecular weight of 571.73 g/mol. Its IUPAC name is chloro-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilylprop-1-enyl]-pyridin-1-ium-1-ylboranuide.
| Compound Name | chloro-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilylprop-1-enyl]-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139174432 |
| Molecular Formula | C23H17BClF10NSi |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | chloro-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilylprop-1-enyl]-pyridin-1-ium-1-ylboranuide |
| SMILES | C/C(=C(\c1c(F)c(F)c(F)c(F)c1F)[B@-](Cl)(c1c(F)c(F)c(F)c(F)c1F)[n+]1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C23H17BClF10NSi/c1-10(37(2,3)4)12(11-14(26)18(30)22(34)19(31)15(11)27)24(25,36-8-6-5-7-9-36)13-16(28)20(32)23(35)21(33)17(13)29/h5-9H,1-4H3/b12-10-/t24-/m1/s1 |
| InChIKey | WAOZUYKJUKDMSO-PFQQOQBSSA-N |
| XLogP | 6.69 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|