C29H29BClF10NSi2 — CID 139174440
chloro-(2,3,4,5,6-pentafluorophenyl)-[(2E,4E)-4-(2,3,4,5,6-pentafluorophenyl)-2,5-bis(trimethylsilyl)hexa-2,4-dien-3-yl]-pyridin-1-ium-1-ylboranuide (PubChem CID 139174440) has the molecular formula C29H29BClF10NSi2 and a molecular weight of 683.98 g/mol. Its IUPAC name is chloro-(2,3,4,5,6-pentafluorophenyl)-[(2E,4E)-4-(2,3,4,5,6-pentafluorophenyl)-2,5-bis(trimethylsilyl)hexa-2,4-dien-3-yl]-pyridin-1-ium-1-ylboranuide.
| Compound Name | chloro-(2,3,4,5,6-pentafluorophenyl)-[(2E,4E)-4-(2,3,4,5,6-pentafluorophenyl)-2,5-bis(trimethylsilyl)hexa-2,4-dien-3-yl]-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139174440 |
| Molecular Formula | C29H29BClF10NSi2 |
| Molecular Weight | 683.98 g/mol |
| Exact Mass | 683.15 |
| IUPAC Name | chloro-(2,3,4,5,6-pentafluorophenyl)-[(2E,4E)-4-(2,3,4,5,6-pentafluorophenyl)-2,5-bis(trimethylsilyl)hexa-2,4-dien-3-yl]-pyridin-1-ium-1-ylboranuide |
| SMILES | C/C(=C(C(=C(/C)[Si](C)(C)C)\[B@-](Cl)(c1c(F)c(F)c(F)c(F)c1F)[n+]1ccccc1)/c1c(F)c(F)c(F)c(F)c1F)[Si](C)(C)C |
| InChI | InChI=1S/C29H29BClF10NSi2/c1-14(43(3,4)5)16(17-20(32)24(36)28(40)25(37)21(17)33)18(15(2)44(6,7)8)30(31,42-12-10-9-11-13-42)19-22(34)26(38)29(41)27(39)23(19)35/h9-13H,1-8H3/b16-14-,18-15-/t30-/m1/s1 |
| InChIKey | DWGWIXWHSJUCBX-UEJNMFQJSA-N |
| XLogP | 8.89 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.98 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|