About cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide)
cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide) (PubChem CID 139174844) has the molecular formula C32H26CoN4O4S2
and a molecular weight of 653.65 g/mol. Its IUPAC name is cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide).
Molecular Properties
| Compound Name | cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide) |
| PubChem CID | 139174844 |
| Molecular Formula | C32H26CoN4O4S2 |
| Molecular Weight | 653.65 g/mol |
| Exact Mass | 653.07 |
| IUPAC Name | cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide) |
| SMILES | O=S(=O)([N-]Cc1ccccn1)c1cccc2ccccc12.O=S(=O)([N-]Cc1ccccn1)c1cccc2ccccc12.[Co+2] |
| InChI | InChI=1S/2C16H13N2O2S.Co/c2*19-21(20,18-12-14-8-3-4-11-17-14)16-10-5-7-13-6-1-2-9-15(13)16;/h2*1-11H,12H2;/q2*-1;+2 |
| InChIKey | RVBHPFAMVXNBFM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 653.65 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide)?
The IUPAC name of cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide) (CID 139174844) is cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide).
What is the SMILES notation for cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide)?
The canonical SMILES for cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide) is O=S(=O)([N-]Cc1ccccn1)c1cccc2ccccc12.O=S(=O)([N-]Cc1ccccn1)c1cccc2ccccc12.[Co+2].
What is the InChIKey of cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide)?
The InChIKey is RVBHPFAMVXNBFM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H13N2O2S.Co/c2*19-21(20,18-12-14-8-3-4-11-17-14)16-10-5-7-13-6-1-2-9-15(13)16;/h2*1-11H,12H2;/q2*-1;+2.
What are the key properties of cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide)?
cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide) has a molecular weight of 653.65 g/mol, XLogP of 6.99, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis(naphthalen-1-ylsulfonyl(pyridin-2-ylmethyl)azanide) is sourced from PubChem (CID 139174844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).