C13H17N3O6 — CID 139175140
cis-(3R,5S)-3,5-dicarboxycyclohexane-1-carboxylate;pyrimidin-1-ium-2-amine (PubChem CID 139175140) has the molecular formula C13H17N3O6 and a molecular weight of 311.29 g/mol. Its IUPAC name is cis-(3R,5S)-3,5-dicarboxycyclohexane-1-carboxylate;pyrimidin-1-ium-2-amine.
| Compound Name | cis-(3R,5S)-3,5-dicarboxycyclohexane-1-carboxylate;pyrimidin-1-ium-2-amine |
|---|---|
| PubChem CID | 139175140 |
| Molecular Formula | C13H17N3O6 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | cis-(3R,5S)-3,5-dicarboxycyclohexane-1-carboxylate;pyrimidin-1-ium-2-amine |
| SMILES | Nc1nccc[nH+]1.O=C([O-])C1C[C@@H](C(=O)O)C[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C9H12O6.C4H5N3/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;5-4-6-2-1-3-7-4/h4-6H,1-3H2,(H,10,11)(H,12,13)(H,14,15);1-3H,(H2,5,6,7) |
| InChIKey | GEBRBPPHSXWNGX-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 167.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |