C41H49FN2O7S — CID 139175143
3-O-[(1S,2S,3R,4R)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 1-O-tert-butyl (3R,4S)-4-(4-fluorophenyl)-2-oxopiperidine-1,3-dicarboxylate (PubChem CID 139175143) has the molecular formula C41H49FN2O7S and a molecular weight of 732.92 g/mol. Its IUPAC name is 3-O-[(1S,2S,3R,4R)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 1-O-tert-butyl (3R,4S)-4-(4-fluorophenyl)-2-oxopiperidine-1,3-dicarboxylate.
| Compound Name | 3-O-[(1S,2S,3R,4R)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 1-O-tert-butyl (3R,4S)-4-(4-fluorophenyl)-2-oxopiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 139175143 |
| Molecular Formula | C41H49FN2O7S |
| Molecular Weight | 732.92 g/mol |
| Exact Mass | 732.32 |
| IUPAC Name | 3-O-[(1S,2S,3R,4R)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 1-O-tert-butyl (3R,4S)-4-(4-fluorophenyl)-2-oxopiperidine-1,3-dicarboxylate |
| SMILES | Cc1cc(C)cc(N([C@H]2[C@@H](OC(=O)[C@H]3C(=O)N(C(=O)OC(C)(C)C)CC[C@@H]3c3ccc(F)cc3)[C@@]3(C)CC[C@@H]2C3(C)C)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C41H49FN2O7S/c1-25-22-26(2)24-29(23-25)44(52(48,49)30-12-10-9-11-13-30)34-32-18-20-41(8,40(32,6)7)35(34)50-37(46)33-31(27-14-16-28(42)17-15-27)19-21-43(36(33)45)38(47)51-39(3,4)5/h9-17,22-24,31-35H,18-21H2,1-8H3/t31-,32+,33-,34-,35-,41-/m1/s1 |
| InChIKey | FKJDEQLDICMTPO-LGGVFEJSSA-N |
| XLogP | 7.94 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.92 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|