C40H64O4Si8 — CID 139175151
2,2,4,4,9,9,11,11-octamethyl-3,10-dioxa-2,4,9,11-tetrasilatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene (PubChem CID 139175151) has the molecular formula C40H64O4Si8 and a molecular weight of 833.64 g/mol. Its IUPAC name is 2,2,4,4,9,9,11,11-octamethyl-3,10-dioxa-2,4,9,11-tetrasilatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene.
| Compound Name | 2,2,4,4,9,9,11,11-octamethyl-3,10-dioxa-2,4,9,11-tetrasilatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene |
|---|---|
| PubChem CID | 139175151 |
| Molecular Formula | C40H64O4Si8 |
| Molecular Weight | 833.64 g/mol |
| Exact Mass | 832.30 |
| IUPAC Name | 2,2,4,4,9,9,11,11-octamethyl-3,10-dioxa-2,4,9,11-tetrasilatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene |
| SMILES | C[Si]1(C)O[Si](C)(C)c2ccc(cc2)[Si](C)(C)O[Si](C)(C)c2ccc1cc2.C[Si]1(C)O[Si](C)(C)c2ccc(cc2)[Si](C)(C)O[Si](C)(C)c2ccc1cc2 |
| InChI | InChI=1S/2C20H32O2Si4/c2*1-23(2)17-9-11-19(12-10-17)25(5,6)22-26(7,8)20-15-13-18(14-16-20)24(3,4)21-23/h2*9-16H,1-8H3 |
| InChIKey | XVHYHLAODBWQBW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.64 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|