C17H20CuN4O2 — CID 139175161
copper;3,5-dimethyl-1H-pyrazole;(NE,Z)-N-[(Z)-4-oxidopent-3-en-2-ylidene]benzenecarbohydrazonate (PubChem CID 139175161) has the molecular formula C17H20CuN4O2 and a molecular weight of 375.92 g/mol. Its IUPAC name is copper;3,5-dimethyl-1H-pyrazole;(NE,Z)-N-[(Z)-4-oxidopent-3-en-2-ylidene]benzenecarbohydrazonate.
| Compound Name | copper;3,5-dimethyl-1H-pyrazole;(NE,Z)-N-[(Z)-4-oxidopent-3-en-2-ylidene]benzenecarbohydrazonate |
|---|---|
| PubChem CID | 139175161 |
| Molecular Formula | C17H20CuN4O2 |
| Molecular Weight | 375.92 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | copper;3,5-dimethyl-1H-pyrazole;(NE,Z)-N-[(Z)-4-oxidopent-3-en-2-ylidene]benzenecarbohydrazonate |
| SMILES | C/C([O-])=C/C(C)=N/N=C(\[O-])c1ccccc1.Cc1cc(C)[nH]n1.[Cu+2] |
| InChI | InChI=1S/C12H14N2O2.C5H8N2.Cu/c1-9(8-10(2)15)13-14-12(16)11-6-4-3-5-7-11;1-4-3-5(2)7-6-4;/h3-8,15H,1-2H3,(H,14,16);3H,1-2H3,(H,6,7);/q;;+2/p-2/b10-8-,13-9+;; |
| InChIKey | GDTLKLRKSGLBMI-UHIUVHHLSA-L |
| XLogP | 1.46 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.92 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|