About thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide
thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide (PubChem CID 139175205) has the molecular formula C24H19BN9Tl
and a molecular weight of 648.67 g/mol. Its IUPAC name is thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide.
Molecular Properties
| Compound Name | thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide |
| PubChem CID | 139175205 |
| Molecular Formula | C24H19BN9Tl |
| Molecular Weight | 648.67 g/mol |
| Exact Mass | 649.16 |
| IUPAC Name | thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide |
| SMILES | [Tl+].c1cc(-c2ccn([BH-](n3ccc(-c4ccncc4)n3)n3ccc(-c4ccncc4)n3)n2)ccn1 |
| InChI | InChI=1S/C24H19BN9.Tl/c1-10-26-11-2-19(1)22-7-16-32(29-22)25(33-17-8-23(30-33)20-3-12-27-13-4-20)34-18-9-24(31-34)21-5-14-28-15-6-21;/h1-18,25H;/q-1;+1 |
| InChIKey | FRWWQJLMXUDMHO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 648.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide?
The IUPAC name of thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide (CID 139175205) is thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide.
What is the SMILES notation for thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide?
The canonical SMILES for thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide is [Tl+].c1cc(-c2ccn([BH-](n3ccc(-c4ccncc4)n3)n3ccc(-c4ccncc4)n3)n2)ccn1.
What is the InChIKey of thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide?
The InChIKey is FRWWQJLMXUDMHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19BN9.Tl/c1-10-26-11-2-19(1)22-7-16-32(29-22)25(33-17-8-23(30-33)20-3-12-27-13-4-20)34-18-9-24(31-34)21-5-14-28-15-6-21;/h1-18,25H;/q-1;+1.
What are the key properties of thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide?
thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide has a molecular weight of 648.67 g/mol, XLogP of 2.74, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for thallium(1+);tris(3-pyridin-4-ylpyrazol-1-yl)boranuide is sourced from PubChem (CID 139175205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).