About 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine
5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine (PubChem CID 139175270) has the molecular formula C30H30N18
and a molecular weight of 642.70 g/mol. Its IUPAC name is 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine |
| PubChem CID | 139175270 |
| Molecular Formula | C30H30N18 |
| Molecular Weight | 642.70 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine |
| SMILES | Nc1nc(Cn2cccn2)nc(Cn2cccn2)c1-n1cccn1.Nc1nc(Cn2cccn2)nc(Cn2cccn2)c1-n1cccn1 |
| InChI | InChI=1S/2C15H15N9/c2*16-15-14(24-9-3-6-19-24)12(10-22-7-1-4-17-22)20-13(21-15)11-23-8-2-5-18-23/h2*1-9H,10-11H2,(H2,16,20,21) |
| InChIKey | VXTIYBGGYWIQKI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 210.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.70 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
Analyze 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine?
The IUPAC name of 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine (CID 139175270) is 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine.
What is the SMILES notation for 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine?
The canonical SMILES for 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine is Nc1nc(Cn2cccn2)nc(Cn2cccn2)c1-n1cccn1.Nc1nc(Cn2cccn2)nc(Cn2cccn2)c1-n1cccn1.
What is the InChIKey of 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine?
The InChIKey is VXTIYBGGYWIQKI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H15N9/c2*16-15-14(24-9-3-6-19-24)12(10-22-7-1-4-17-22)20-13(21-15)11-23-8-2-5-18-23/h2*1-9H,10-11H2,(H2,16,20,21).
What are the key properties of 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine?
5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine has a molecular weight of 642.70 g/mol, XLogP of 1.47, 10 rotatable bonds, 2 hydrogen bond donors, and 18 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrazol-1-yl-2,6-bis(pyrazol-1-ylmethyl)pyrimidin-4-amine is sourced from PubChem (CID 139175270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).