C20H21N5O3 — CID 139175326
ethyl (11aS)-5-methyl-1-(4-methylphenyl)-6-oxo-11,11a-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]benzotriazepine-3-carboxylate (PubChem CID 139175326) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is ethyl (11aS)-5-methyl-1-(4-methylphenyl)-6-oxo-11,11a-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]benzotriazepine-3-carboxylate.
| Compound Name | ethyl (11aS)-5-methyl-1-(4-methylphenyl)-6-oxo-11,11a-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]benzotriazepine-3-carboxylate |
|---|---|
| PubChem CID | 139175326 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | ethyl (11aS)-5-methyl-1-(4-methylphenyl)-6-oxo-11,11a-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]benzotriazepine-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc(C)cc2)[C@@H]2Nc3ccccc3C(=O)N(C)N12 |
| InChI | InChI=1S/C20H21N5O3/c1-4-28-19(27)17-22-24(14-11-9-13(2)10-12-14)20-21-16-8-6-5-7-15(16)18(26)23(3)25(17)20/h5-12,20-21H,4H2,1-3H3/t20-/m0/s1 |
| InChIKey | FLAJRDHWHXBXAU-FQEVSTJZSA-N |
| XLogP | 2.39 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |