C23H14F6N4S2 — CID 139175590
(6R,7R)-13,13,14,14,15,15-hexafluoro-6,7-dimethyl-4,9-dipyridin-2-yl-5,8-dithia-3,10-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,9,11-tetraene (PubChem CID 139175590) has the molecular formula C23H14F6N4S2 and a molecular weight of 524.52 g/mol. Its IUPAC name is (6R,7R)-13,13,14,14,15,15-hexafluoro-6,7-dimethyl-4,9-dipyridin-2-yl-5,8-dithia-3,10-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,9,11-tetraene.
| Compound Name | (6R,7R)-13,13,14,14,15,15-hexafluoro-6,7-dimethyl-4,9-dipyridin-2-yl-5,8-dithia-3,10-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,9,11-tetraene |
|---|---|
| PubChem CID | 139175590 |
| Molecular Formula | C23H14F6N4S2 |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | (6R,7R)-13,13,14,14,15,15-hexafluoro-6,7-dimethyl-4,9-dipyridin-2-yl-5,8-dithia-3,10-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,9,11-tetraene |
| SMILES | C[C@@]12SC(c3ccccn3)=NC1=C1C(=C3N=C(c4ccccn4)S[C@]32C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C23H14F6N4S2/c1-19-15(32-17(34-19)11-7-3-5-9-30-11)13-14(22(26,27)23(28,29)21(13,24)25)16-20(19,2)35-18(33-16)12-8-4-6-10-31-12/h3-10H,1-2H3/t19-,20-/m1/s1 |
| InChIKey | RYUATGQDOZCCBA-WOJBJXKFSA-N |
| XLogP | 6.12 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|