C48H54Br2F4N2O2 — CID 139175623
1,4-dibromo-2,3,5,6-tetrafluorobenzene;bis(4-[(E)-2-(4-octoxyphenyl)ethenyl]pyridine) (PubChem CID 139175623) has the molecular formula C48H54Br2F4N2O2 and a molecular weight of 926.77 g/mol. Its IUPAC name is 1,4-dibromo-2,3,5,6-tetrafluorobenzene;bis(4-[(E)-2-(4-octoxyphenyl)ethenyl]pyridine).
| Compound Name | 1,4-dibromo-2,3,5,6-tetrafluorobenzene;bis(4-[(E)-2-(4-octoxyphenyl)ethenyl]pyridine) |
|---|---|
| PubChem CID | 139175623 |
| Molecular Formula | C48H54Br2F4N2O2 |
| Molecular Weight | 926.77 g/mol |
| Exact Mass | 924.25 |
| IUPAC Name | 1,4-dibromo-2,3,5,6-tetrafluorobenzene;bis(4-[(E)-2-(4-octoxyphenyl)ethenyl]pyridine) |
| SMILES | CCCCCCCCOc1ccc(/C=C/c2ccncc2)cc1.CCCCCCCCOc1ccc(/C=C/c2ccncc2)cc1.Fc1c(F)c(Br)c(F)c(F)c1Br |
| InChI | InChI=1S/2C21H27NO.C6Br2F4/c2*1-2-3-4-5-6-7-18-23-21-12-10-19(11-13-21)8-9-20-14-16-22-17-15-20;7-1-3(9)5(11)2(8)6(12)4(1)10/h2*8-17H,2-7,18H2,1H3;/b2*9-8+; |
| InChIKey | DZSAABGQYAPAMA-KZLSPNFISA-N |
| XLogP | 15.75 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.77 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|