About benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione
benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione (PubChem CID 139175730) has the molecular formula C11H8FN3O2
and a molecular weight of 233.20 g/mol. Its IUPAC name is benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione |
| PubChem CID | 139175730 |
| Molecular Formula | C11H8FN3O2 |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione |
| SMILES | N#Cc1ccccc1.O=c1[nH]cc(F)c(=O)[nH]1 |
| InChI | InChI=1S/C7H5N.C4H3FN2O2/c8-6-7-4-2-1-3-5-7;5-2-1-6-4(9)7-3(2)8/h1-5H;1H,(H2,6,7,8,9) |
| InChIKey | KKRITPHOUUPBGJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione?
The IUPAC name of benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione (CID 139175730) is benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione.
What is the SMILES notation for benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione?
The canonical SMILES for benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione is N#Cc1ccccc1.O=c1[nH]cc(F)c(=O)[nH]1.
What is the InChIKey of benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione?
The InChIKey is KKRITPHOUUPBGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N.C4H3FN2O2/c8-6-7-4-2-1-3-5-7;5-2-1-6-4(9)7-3(2)8/h1-5H;1H,(H2,6,7,8,9).
What are the key properties of benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione?
benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione has a molecular weight of 233.20 g/mol, XLogP of 0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzonitrile;5-fluoro-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 139175730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).