C11H15N2+ — CID 139176407
3-methyl-2-phenyl-1,4,5,6-tetrahydropyrimidin-3-ium (PubChem CID 139176407) has the molecular formula C11H15N2+ and a molecular weight of 175.26 g/mol. Its IUPAC name is 3-methyl-2-phenyl-1,4,5,6-tetrahydropyrimidin-3-ium.
| Compound Name | 3-methyl-2-phenyl-1,4,5,6-tetrahydropyrimidin-3-ium |
|---|---|
| PubChem CID | 139176407 |
| Molecular Formula | C11H15N2+ |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 3-methyl-2-phenyl-1,4,5,6-tetrahydropyrimidin-3-ium |
| SMILES | C[N+]1=C(c2ccccc2)NCCC1 |
| InChI | InChI=1S/C11H14N2/c1-13-9-5-8-12-11(13)10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3/p+1 |
| InChIKey | VVVNETWYMZMQMK-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|