C11H22N2PSSe- — CID 139176810
(1Z)-N-di(propan-2-yl)phosphinothioylpyrrolidine-1-carboximidoselenoate (PubChem CID 139176810) has the molecular formula C11H22N2PSSe- and a molecular weight of 324.31 g/mol. Its IUPAC name is (1Z)-N-di(propan-2-yl)phosphinothioylpyrrolidine-1-carboximidoselenoate.
| Compound Name | (1Z)-N-di(propan-2-yl)phosphinothioylpyrrolidine-1-carboximidoselenoate |
|---|---|
| PubChem CID | 139176810 |
| Molecular Formula | C11H22N2PSSe- |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (1Z)-N-di(propan-2-yl)phosphinothioylpyrrolidine-1-carboximidoselenoate |
| SMILES | CC(C)P(=S)(/N=C(\[Se-])N1CCCC1)C(C)C |
| InChI | InChI=1S/C11H23N2PSSe/c1-9(2)14(15,10(3)4)12-11(16)13-7-5-6-8-13/h9-10H,5-8H2,1-4H3,(H,12,15,16)/p-1 |
| InChIKey | UIPMYIVGESPAAY-UHFFFAOYSA-M |
| XLogP | 2.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|