About 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde
2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde (PubChem CID 139177002) has the molecular formula C58H42N6O4
and a molecular weight of 887.01 g/mol. Its IUPAC name is 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde.
Molecular Properties
| Compound Name | 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde |
| PubChem CID | 139177002 |
| Molecular Formula | C58H42N6O4 |
| Molecular Weight | 887.01 g/mol |
| Exact Mass | 886.33 |
| IUPAC Name | 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde |
| SMILES | O=Cc1ccccc1OCc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1.O=Cc1ccccc1OCc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/2C29H21N3O2/c2*33-19-23-7-1-2-10-29(23)34-20-21-11-13-22(14-12-21)24-17-27(25-8-3-5-15-30-25)32-28(18-24)26-9-4-6-16-31-26/h2*1-19H,20H2 |
| InChIKey | QUCRCQKNTXHACP-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 129.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 887.01 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde?
The IUPAC name of 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde (CID 139177002) is 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde.
What is the SMILES notation for 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde?
The canonical SMILES for 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde is O=Cc1ccccc1OCc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1.O=Cc1ccccc1OCc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1.
What is the InChIKey of 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde?
The InChIKey is QUCRCQKNTXHACP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C29H21N3O2/c2*33-19-23-7-1-2-10-29(23)34-20-21-11-13-22(14-12-21)24-17-27(25-8-3-5-15-30-25)32-28(18-24)26-9-4-6-16-31-26/h2*1-19H,20H2.
What are the key properties of 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde?
2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde has a molecular weight of 887.01 g/mol, XLogP of 12.53, 14 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]methoxy]benzaldehyde is sourced from PubChem (CID 139177002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).