C7H6N8O8 — CID 139177654
4-(5-methyl-1,2,4-oxadiazol-3-yl)-N-(2,2,2-trinitroethyl)-1,2,5-oxadiazol-3-amine (PubChem CID 139177654) has the molecular formula C7H6N8O8 and a molecular weight of 330.17 g/mol. Its IUPAC name is 4-(5-methyl-1,2,4-oxadiazol-3-yl)-N-(2,2,2-trinitroethyl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(5-methyl-1,2,4-oxadiazol-3-yl)-N-(2,2,2-trinitroethyl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 139177654 |
| Molecular Formula | C7H6N8O8 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 4-(5-methyl-1,2,4-oxadiazol-3-yl)-N-(2,2,2-trinitroethyl)-1,2,5-oxadiazol-3-amine |
| SMILES | Cc1nc(-c2nonc2NCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])no1 |
| InChI | InChI=1S/C7H6N8O8/c1-3-9-6(11-22-3)4-5(12-23-10-4)8-2-7(13(16)17,14(18)19)15(20)21/h2H2,1H3,(H,8,12) |
| InChIKey | DSGXXPNNGZJJKL-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 219.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|