C27H20CuN4O3 — CID 139177741
copper;(NE,Z)-N-[(4-methoxy-2-oxidophenyl)methylidene]benzenecarbohydrazonate;1,10-phenanthroline (PubChem CID 139177741) has the molecular formula C27H20CuN4O3 and a molecular weight of 512.03 g/mol. Its IUPAC name is copper;(NE,Z)-N-[(4-methoxy-2-oxidophenyl)methylidene]benzenecarbohydrazonate;1,10-phenanthroline.
| Compound Name | copper;(NE,Z)-N-[(4-methoxy-2-oxidophenyl)methylidene]benzenecarbohydrazonate;1,10-phenanthroline |
|---|---|
| PubChem CID | 139177741 |
| Molecular Formula | C27H20CuN4O3 |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | copper;(NE,Z)-N-[(4-methoxy-2-oxidophenyl)methylidene]benzenecarbohydrazonate;1,10-phenanthroline |
| SMILES | COc1ccc(/C=N/N=C(\[O-])c2ccccc2)c([O-])c1.[Cu+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C15H14N2O3.C12H8N2.Cu/c1-20-13-8-7-12(14(18)9-13)10-16-17-15(19)11-5-3-2-4-6-11;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h2-10,18H,1H3,(H,17,19);1-8H;/q;;+2/p-2/b16-10+;; |
| InChIKey | OXPNKKSTGGNWEW-CNSDMJOKSA-L |
| XLogP | 3.69 |
| TPSA | 105.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|