C15H20N2O3 — CID 139177904
(2S,4R)-2,4-dipyridin-2-ylpentane-2,4-diol;hydrate (PubChem CID 139177904) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (2S,4R)-2,4-dipyridin-2-ylpentane-2,4-diol;hydrate.
| Compound Name | (2S,4R)-2,4-dipyridin-2-ylpentane-2,4-diol;hydrate |
|---|---|
| PubChem CID | 139177904 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (2S,4R)-2,4-dipyridin-2-ylpentane-2,4-diol;hydrate |
| SMILES | C[C@](O)(C[C@@](C)(O)c1ccccn1)c1ccccn1.O |
| InChI | InChI=1S/C15H18N2O2.H2O/c1-14(18,12-7-3-5-9-16-12)11-15(2,19)13-8-4-6-10-17-13;/h3-10,18-19H,11H2,1-2H3;1H2/t14-,15+; |
| InChIKey | AWHVMJHRAQURCA-KBGJBQQCSA-N |
| XLogP | 1.16 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |