About (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one
(Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one (PubChem CID 139178701) has the molecular formula C12H12N2O3
and a molecular weight of 232.24 g/mol. Its IUPAC name is (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one |
| PubChem CID | 139178701 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one |
| SMILES | Cc1cc(/C(O)=C/C(=O)c2ccco2)nn1C |
| InChI | InChI=1S/C12H12N2O3/c1-8-6-9(13-14(8)2)10(15)7-11(16)12-4-3-5-17-12/h3-7,15H,1-2H3/b10-7- |
| InChIKey | CJVCSEVMIRSHAC-YFHOEESVSA-N |
| XLogP | 2.10 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one?
The IUPAC name of (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one (CID 139178701) is (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one.
What is the SMILES notation for (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one?
The canonical SMILES for (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one is Cc1cc(/C(O)=C/C(=O)c2ccco2)nn1C.
What is the InChIKey of (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one?
The InChIKey is CJVCSEVMIRSHAC-YFHOEESVSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-8-6-9(13-14(8)2)10(15)7-11(16)12-4-3-5-17-12/h3-7,15H,1-2H3/b10-7-.
What are the key properties of (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one?
(Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one has a molecular weight of 232.24 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(1,5-dimethylpyrazol-3-yl)-1-(furan-2-yl)-3-hydroxyprop-2-en-1-one is sourced from PubChem (CID 139178701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).