About 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole
4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole (PubChem CID 139179042) has the molecular formula C6H2N8O8
and a molecular weight of 314.13 g/mol. Its IUPAC name is 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole.
Molecular Properties
| Compound Name | 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole |
| PubChem CID | 139179042 |
| Molecular Formula | C6H2N8O8 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole |
| SMILES | O=[N+]([O-])c1n[nH]c([N+](=O)[O-])c1-c1c([N+](=O)[O-])n[nH]c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H2N8O8/c15-11(16)3-1(4(8-7-3)12(17)18)2-5(13(19)20)9-10-6(2)14(21)22/h(H,7,8)(H,9,10) |
| InChIKey | OWXVSTYOFTZTSE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 229.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole?
The IUPAC name of 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole (CID 139179042) is 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole.
What is the SMILES notation for 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole?
The canonical SMILES for 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole is O=[N+]([O-])c1n[nH]c([N+](=O)[O-])c1-c1c([N+](=O)[O-])n[nH]c1[N+](=O)[O-].
What is the InChIKey of 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole?
The InChIKey is OWXVSTYOFTZTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2N8O8/c15-11(16)3-1(4(8-7-3)12(17)18)2-5(13(19)20)9-10-6(2)14(21)22/h(H,7,8)(H,9,10).
What are the key properties of 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole?
4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole has a molecular weight of 314.13 g/mol, XLogP of 0.43, 5 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dinitro-1H-pyrazol-4-yl)-3,5-dinitro-1H-pyrazole is sourced from PubChem (CID 139179042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).