C47H35Cl3N2 — CID 139179155
chloroform;N,N-diphenyl-4-[4-[4-(N-phenylanilino)phenyl]naphthalen-1-yl]aniline (PubChem CID 139179155) has the molecular formula C47H35Cl3N2 and a molecular weight of 734.17 g/mol. Its IUPAC name is chloroform;N,N-diphenyl-4-[4-[4-(N-phenylanilino)phenyl]naphthalen-1-yl]aniline.
| Compound Name | chloroform;N,N-diphenyl-4-[4-[4-(N-phenylanilino)phenyl]naphthalen-1-yl]aniline |
|---|---|
| PubChem CID | 139179155 |
| Molecular Formula | C47H35Cl3N2 |
| Molecular Weight | 734.17 g/mol |
| Exact Mass | 732.19 |
| IUPAC Name | chloroform;N,N-diphenyl-4-[4-[4-(N-phenylanilino)phenyl]naphthalen-1-yl]aniline |
| SMILES | ClC(Cl)Cl.c1ccc(N(c2ccccc2)c2ccc(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C46H34N2.CHCl3/c1-5-15-37(16-6-1)47(38-17-7-2-8-18-38)41-29-25-35(26-30-41)43-33-34-44(46-24-14-13-23-45(43)46)36-27-31-42(32-28-36)48(39-19-9-3-10-20-39)40-21-11-4-12-22-40;2-1(3)4/h1-34H;1H |
| InChIKey | WTBDBJVBLXBFOP-UHFFFAOYSA-N |
| XLogP | 15.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.17 |
| LogP ≤ 5 | 15.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|