C6H16N18O6 — CID 139179196
(hydrazinecarbonylamino)azanium;nitro-[3-(5-nitroazanidyl-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-5-yl]azanide (PubChem CID 139179196) has the molecular formula C6H16N18O6 and a molecular weight of 436.31 g/mol. Its IUPAC name is (hydrazinecarbonylamino)azanium;nitro-[3-(5-nitroazanidyl-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-5-yl]azanide.
| Compound Name | (hydrazinecarbonylamino)azanium;nitro-[3-(5-nitroazanidyl-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-5-yl]azanide |
|---|---|
| PubChem CID | 139179196 |
| Molecular Formula | C6H16N18O6 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (hydrazinecarbonylamino)azanium;nitro-[3-(5-nitroazanidyl-1H-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-5-yl]azanide |
| SMILES | NNC(=O)N[NH3+].NNC(=O)N[NH3+].O=[N+]([O-])[N-]c1nc(-c2n[nH]c([N-][N+](=O)[O-])n2)n[nH]1 |
| InChI | InChI=1S/C4H2N10O4.2CH6N4O/c15-13(16)11-3-5-1(7-9-3)2-6-4(10-8-2)12-14(17)18;2*2-4-1(6)5-3/h(H2-2,5,6,7,8,9,10,11,12);2*2-3H2,(H2,4,5,6)/q-2;;/p+2 |
| InChIKey | JRYAZDVGOFPVJR-UHFFFAOYSA-P |
| XLogP | -5.38 |
| TPSA | 387.20 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | -5.38 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|