About 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide
2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide (PubChem CID 139179611) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide.
Molecular Properties
| Compound Name | 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide |
| PubChem CID | 139179611 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide |
| SMILES | C[n+]1[c-]n2ccccc2c1 |
| InChI | InChI=1S/C8H8N2/c1-9-6-8-4-2-3-5-10(8)7-9/h2-6H,1H3 |
| InChIKey | CGTDSZUUBGYNSJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide?
The IUPAC name of 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide (CID 139179611) is 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide.
What is the SMILES notation for 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide?
The canonical SMILES for 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide is C[n+]1[c-]n2ccccc2c1.
What is the InChIKey of 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide?
The InChIKey is CGTDSZUUBGYNSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-9-6-8-4-2-3-5-10(8)7-9/h2-6H,1H3.
What are the key properties of 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide?
2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide has a molecular weight of 132.17 g/mol, XLogP of 0.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3H-imidazo[1,5-a]pyridin-2-ium-3-ide is sourced from PubChem (CID 139179611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).