C20H18O8 — CID 139179614
benzene-1,4-diol;bis(2-methoxycyclohexa-2,5-diene-1,4-dione) (PubChem CID 139179614) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is benzene-1,4-diol;bis(2-methoxycyclohexa-2,5-diene-1,4-dione).
| Compound Name | benzene-1,4-diol;bis(2-methoxycyclohexa-2,5-diene-1,4-dione) |
|---|---|
| PubChem CID | 139179614 |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | benzene-1,4-diol;bis(2-methoxycyclohexa-2,5-diene-1,4-dione) |
| SMILES | COC1=CC(=O)C=CC1=O.COC1=CC(=O)C=CC1=O.Oc1ccc(O)cc1 |
| InChI | InChI=1S/2C7H6O3.C6H6O2/c2*1-10-7-4-5(8)2-3-6(7)9;7-5-1-2-6(8)4-3-5/h2*2-4H,1H3;1-4,7-8H |
| InChIKey | SMUYMBAYAQJZOG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|