C10H8F8I2N2 — CID 139180285
hexanedinitrile;1,1,2,2,3,3,4,4-octafluoro-1,4-diiodobutane (PubChem CID 139180285) has the molecular formula C10H8F8I2N2 and a molecular weight of 561.98 g/mol. Its IUPAC name is hexanedinitrile;1,1,2,2,3,3,4,4-octafluoro-1,4-diiodobutane.
| Compound Name | hexanedinitrile;1,1,2,2,3,3,4,4-octafluoro-1,4-diiodobutane |
|---|---|
| PubChem CID | 139180285 |
| Molecular Formula | C10H8F8I2N2 |
| Molecular Weight | 561.98 g/mol |
| Exact Mass | 561.86 |
| IUPAC Name | hexanedinitrile;1,1,2,2,3,3,4,4-octafluoro-1,4-diiodobutane |
| SMILES | FC(F)(I)C(F)(F)C(F)(F)C(F)(F)I.N#CCCCCC#N |
| InChI | InChI=1S/C6H8N2.C4F8I2/c7-5-3-1-2-4-6-8;5-1(6,3(9,10)13)2(7,8)4(11,12)14/h1-4H2; |
| InChIKey | JVTPRJXMPYEKPU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.98 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|