C17H13NO4S2 — CID 139180902
2,6-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine (PubChem CID 139180902) has the molecular formula C17H13NO4S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2,6-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine.
| Compound Name | 2,6-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine |
|---|---|
| PubChem CID | 139180902 |
| Molecular Formula | C17H13NO4S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 2,6-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine |
| SMILES | c1cc(-c2scc3c2OCCO3)nc(-c2scc3c2OCCO3)c1 |
| InChI | InChI=1S/C17H13NO4S2/c1-2-10(16-14-12(8-23-16)19-4-6-21-14)18-11(3-1)17-15-13(9-24-17)20-5-7-22-15/h1-3,8-9H,4-7H2 |
| InChIKey | ZURMPWWCMCEITF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |