C49H66N8O12 — CID 139181142
2-nitro-N-[[2,4,6-trimethyl-3,5-bis[[(2-nitrobenzoyl)amino]methyl]phenyl]methyl]benzamide;tetrabutylazanium;nitrate (PubChem CID 139181142) has the molecular formula C49H66N8O12 and a molecular weight of 959.11 g/mol. Its IUPAC name is 2-nitro-N-[[2,4,6-trimethyl-3,5-bis[[(2-nitrobenzoyl)amino]methyl]phenyl]methyl]benzamide;tetrabutylazanium;nitrate.
| Compound Name | 2-nitro-N-[[2,4,6-trimethyl-3,5-bis[[(2-nitrobenzoyl)amino]methyl]phenyl]methyl]benzamide;tetrabutylazanium;nitrate |
|---|---|
| PubChem CID | 139181142 |
| Molecular Formula | C49H66N8O12 |
| Molecular Weight | 959.11 g/mol |
| Exact Mass | 958.48 |
| IUPAC Name | 2-nitro-N-[[2,4,6-trimethyl-3,5-bis[[(2-nitrobenzoyl)amino]methyl]phenyl]methyl]benzamide;tetrabutylazanium;nitrate |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Cc1c(CNC(=O)c2ccccc2[N+](=O)[O-])c(C)c(CNC(=O)c2ccccc2[N+](=O)[O-])c(C)c1CNC(=O)c1ccccc1[N+](=O)[O-].O=[N+]([O-])[O-] |
| InChI | InChI=1S/C33H30N6O9.C16H36N.NO3/c1-19-25(16-34-31(40)22-10-4-7-13-28(22)37(43)44)20(2)27(18-36-33(42)24-12-6-9-15-30(24)39(47)48)21(3)26(19)17-35-32(41)23-11-5-8-14-29(23)38(45)46;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3)4/h4-15H,16-18H2,1-3H3,(H,34,40)(H,35,41)(H,36,42);5-16H2,1-4H3;/q;+1;-1 |
| InChIKey | JZNYQJVMNURAJF-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 282.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.11 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|