C18H24O7 — CID 139181334
[(1S,2R,6R,7R,9S,11R,16R)-4,4,11-trimethyl-14-oxo-3,5,8,10-tetraoxatetracyclo[7.7.0.02,6.011,16]hexadec-12-en-7-yl]methyl acetate (PubChem CID 139181334) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is [(1S,2R,6R,7R,9S,11R,16R)-4,4,11-trimethyl-14-oxo-3,5,8,10-tetraoxatetracyclo[7.7.0.02,6.011,16]hexadec-12-en-7-yl]methyl acetate.
| Compound Name | [(1S,2R,6R,7R,9S,11R,16R)-4,4,11-trimethyl-14-oxo-3,5,8,10-tetraoxatetracyclo[7.7.0.02,6.011,16]hexadec-12-en-7-yl]methyl acetate |
|---|---|
| PubChem CID | 139181334 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [(1S,2R,6R,7R,9S,11R,16R)-4,4,11-trimethyl-14-oxo-3,5,8,10-tetraoxatetracyclo[7.7.0.02,6.011,16]hexadec-12-en-7-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H]2O[C@]3(C)C=CC(=O)C[C@@H]3[C@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H24O7/c1-9(19)21-8-12-14-15(24-17(2,3)23-14)13-11-7-10(20)5-6-18(11,4)25-16(13)22-12/h5-6,11-16H,7-8H2,1-4H3/t11-,12-,13+,14+,15-,16+,18-/m1/s1 |
| InChIKey | JRRHWZKJLCSHSD-JDLDVZEOSA-N |
| XLogP | 1.34 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |