C26H20FeN6O4 — CID 139181447
bis((NE,1Z)-4-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonate);iron(2+) (PubChem CID 139181447) has the molecular formula C26H20FeN6O4 and a molecular weight of 536.33 g/mol. Its IUPAC name is bis((NE,1Z)-4-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonate);iron(2+).
| Compound Name | bis((NE,1Z)-4-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonate);iron(2+) |
|---|---|
| PubChem CID | 139181447 |
| Molecular Formula | C26H20FeN6O4 |
| Molecular Weight | 536.33 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | bis((NE,1Z)-4-hydroxy-N-(pyridin-2-ylmethylidene)benzenecarbohydrazonate);iron(2+) |
| SMILES | [Fe+2].[O-]/C(=N\N=C\c1ccccn1)c1ccc(O)cc1.[O-]/C(=N\N=C\c1ccccn1)c1ccc(O)cc1 |
| InChI | InChI=1S/2C13H11N3O2.Fe/c2*17-12-6-4-10(5-7-12)13(18)16-15-9-11-3-1-2-8-14-11;/h2*1-9,17H,(H,16,18);/q;;+2/p-2/b2*15-9+; |
| InChIKey | LGNPODAECSZMRM-CGZWKZIFSA-L |
| XLogP | 1.85 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|