C15H22O2 — CID 139182225
(1R,6S,9R,11Z)-tricyclo[7.6.0.01,6]pentadeca-3,11-diene-6,9-diol (PubChem CID 139182225) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1R,6S,9R,11Z)-tricyclo[7.6.0.01,6]pentadeca-3,11-diene-6,9-diol.
| Compound Name | (1R,6S,9R,11Z)-tricyclo[7.6.0.01,6]pentadeca-3,11-diene-6,9-diol |
|---|---|
| PubChem CID | 139182225 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1R,6S,9R,11Z)-tricyclo[7.6.0.01,6]pentadeca-3,11-diene-6,9-diol |
| SMILES | O[C@@]12CC=CC[C@]13CCC/C=C\C[C@]3(O)CC2 |
| InChI | InChI=1S/C15H22O2/c16-14-9-4-2-1-3-7-13(14)8-5-6-10-15(13,17)12-11-14/h2,4-6,16-17H,1,3,7-12H2/b4-2-/t13-,14-,15+/m0/s1 |
| InChIKey | AXHZNXDFOQOYOW-NCJWUYRSSA-N |
| XLogP | 2.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|