C60H58N2 — CID 139182591
7,9-bis(2,6-dimethylphenyl)-2,4-dimethylpyrido[1,2-a]indole (PubChem CID 139182591) has the molecular formula C60H58N2 and a molecular weight of 807.14 g/mol. Its IUPAC name is 7,9-bis(2,6-dimethylphenyl)-2,4-dimethylpyrido[1,2-a]indole.
| Compound Name | 7,9-bis(2,6-dimethylphenyl)-2,4-dimethylpyrido[1,2-a]indole |
|---|---|
| PubChem CID | 139182591 |
| Molecular Formula | C60H58N2 |
| Molecular Weight | 807.14 g/mol |
| Exact Mass | 806.46 |
| IUPAC Name | 7,9-bis(2,6-dimethylphenyl)-2,4-dimethylpyrido[1,2-a]indole |
| SMILES | Cc1cc(C)c2c(c1)cc1c(-c3c(C)cccc3C)cc(-c3c(C)cccc3C)cn12.Cc1cc(C)c2c(c1)cc1c(-c3c(C)cccc3C)cc(-c3c(C)cccc3C)cn12 |
| InChI | InChI=1S/2C30H29N/c2*1-18-13-23(6)30-24(14-18)16-27-26(29-21(4)11-8-12-22(29)5)15-25(17-31(27)30)28-19(2)9-7-10-20(28)3/h2*7-17H,1-6H3 |
| InChIKey | NBWGSIDQXRIBML-UHFFFAOYSA-N |
| XLogP | 16.55 |
| TPSA | 8.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.14 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |