C31H29BF2N2O3S3 — CID 139182621
2,2-difluoro-4,6,10,12-tetramethyl-8-[2-[(R)-(4-methylphenyl)sulfinyl]-5-(4-methylphenyl)sulfonylthiophen-3-yl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139182621) has the molecular formula C31H29BF2N2O3S3 and a molecular weight of 622.59 g/mol. Its IUPAC name is 2,2-difluoro-4,6,10,12-tetramethyl-8-[2-[(R)-(4-methylphenyl)sulfinyl]-5-(4-methylphenyl)sulfonylthiophen-3-yl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-[2-[(R)-(4-methylphenyl)sulfinyl]-5-(4-methylphenyl)sulfonylthiophen-3-yl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139182621 |
| Molecular Formula | C31H29BF2N2O3S3 |
| Molecular Weight | 622.59 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-[2-[(R)-(4-methylphenyl)sulfinyl]-5-(4-methylphenyl)sulfonylthiophen-3-yl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1cc(S(=O)(=O)c3ccc(C)cc3)sc1[S@](=O)c1ccc(C)cc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C31H29BF2N2O3S3/c1-18-7-11-24(12-8-18)41(37)31-26(17-27(40-31)42(38,39)25-13-9-19(2)10-14-25)28-29-20(3)15-22(5)35(29)32(33,34)36-23(6)16-21(4)30(28)36/h7-17H,1-6H3/t41-/m1/s1 |
| InChIKey | PVLVJFRLGFOUIR-VQJSHJPSSA-N |
| XLogP | 7.21 |
| TPSA | 59.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.59 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|