C31H29BF2N2O4S3 — CID 139182622
8-[2,5-bis-(4-methylphenyl)sulfonylthiophen-3-yl]-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139182622) has the molecular formula C31H29BF2N2O4S3 and a molecular weight of 638.59 g/mol. Its IUPAC name is 8-[2,5-bis-(4-methylphenyl)sulfonylthiophen-3-yl]-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 8-[2,5-bis-(4-methylphenyl)sulfonylthiophen-3-yl]-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139182622 |
| Molecular Formula | C31H29BF2N2O4S3 |
| Molecular Weight | 638.59 g/mol |
| Exact Mass | 638.14 |
| IUPAC Name | 8-[2,5-bis-(4-methylphenyl)sulfonylthiophen-3-yl]-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1cc(S(=O)(=O)c3ccc(C)cc3)sc1S(=O)(=O)c1ccc(C)cc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C31H29BF2N2O4S3/c1-18-7-11-24(12-8-18)42(37,38)27-17-26(31(41-27)43(39,40)25-13-9-19(2)10-14-25)28-29-20(3)15-22(5)35(29)32(33,34)36-23(6)16-21(4)30(28)36/h7-17H,1-6H3 |
| InChIKey | LTHRPKZJDRKLHV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 76.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.59 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|