C36H31N7+4 — CID 139182739
8-azido-5,12,19,26-tetrazoniaheptacyclo[24.2.2.22,5.27,10.212,15.216,19.221,24]tetraconta-1(29),2(40),3,5(39),7,9,12,14,16(34),17,19(33),21(32),22,24(31),26(30),27,35,37-octadecaene (PubChem CID 139182739) has the molecular formula C36H31N7+4 and a molecular weight of 561.69 g/mol. Its IUPAC name is 8-azido-5,12,19,26-tetrazoniaheptacyclo[24.2.2.22,5.27,10.212,15.216,19.221,24]tetraconta-1(29),2(40),3,5(39),7,9,12,14,16(34),17,19(33),21(32),22,24(31),26(30),27,35,37-octadecaene.
| Compound Name | 8-azido-5,12,19,26-tetrazoniaheptacyclo[24.2.2.22,5.27,10.212,15.216,19.221,24]tetraconta-1(29),2(40),3,5(39),7,9,12,14,16(34),17,19(33),21(32),22,24(31),26(30),27,35,37-octadecaene |
|---|---|
| PubChem CID | 139182739 |
| Molecular Formula | C36H31N7+4 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | 8-azido-5,12,19,26-tetrazoniaheptacyclo[24.2.2.22,5.27,10.212,15.216,19.221,24]tetraconta-1(29),2(40),3,5(39),7,9,12,14,16(34),17,19(33),21(32),22,24(31),26(30),27,35,37-octadecaene |
| SMILES | [N-]=[N+]=Nc1cc2ccc1C[n+]1ccc(cc1)-c1cc[n+](cc1)Cc1ccc(cc1)C[n+]1ccc(cc1)-c1cc[n+](cc1)C2 |
| InChI | InChI=1S/C36H31N7/c37-39-38-36-23-30-5-6-35(36)27-43-21-13-34(14-22-43)32-9-17-41(18-10-32)25-29-3-1-28(2-4-29)24-40-15-7-31(8-16-40)33-11-19-42(26-30)20-12-33/h1-23H,24-27H2/q+4 |
| InChIKey | JSZJUSLWHAQNPJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|