C14H21N3O4S — CID 139182784
(2S)-2-[(2-acetamidophenyl)sulfonylamino]-N,3-dimethylbutanamide (PubChem CID 139182784) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is (2S)-2-[(2-acetamidophenyl)sulfonylamino]-N,3-dimethylbutanamide.
| Compound Name | (2S)-2-[(2-acetamidophenyl)sulfonylamino]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 139182784 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (2S)-2-[(2-acetamidophenyl)sulfonylamino]-N,3-dimethylbutanamide |
| SMILES | CNC(=O)[C@@H](NS(=O)(=O)c1ccccc1NC(C)=O)C(C)C |
| InChI | InChI=1S/C14H21N3O4S/c1-9(2)13(14(19)15-4)17-22(20,21)12-8-6-5-7-11(12)16-10(3)18/h5-9,13,17H,1-4H3,(H,15,19)(H,16,18)/t13-/m0/s1 |
| InChIKey | OGLOCDJKZPOIDO-ZDUSSCGKSA-N |
| XLogP | 0.69 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |