About methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate
methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate (PubChem CID 139183019) has the molecular formula C30H24F9N3O6
and a molecular weight of 693.52 g/mol. Its IUPAC name is methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate |
| PubChem CID | 139183019 |
| Molecular Formula | C30H24F9N3O6 |
| Molecular Weight | 693.52 g/mol |
| Exact Mass | 693.15 |
| IUPAC Name | methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(/C=C/C(F)(F)F)c1.COC(=O)c1cncc(/C=C/C(F)(F)F)c1.COC(=O)c1cncc(/C=C/C(F)(F)F)c1 |
| InChI | InChI=1S/3C10H8F3NO2/c3*1-16-9(15)8-4-7(5-14-6-8)2-3-10(11,12)13/h3*2-6H,1H3/b3*3-2+ |
| InChIKey | NZERSVCCJNWHKD-FDRFSGEISA-N |
| XLogP | 7.33 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 693.52 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate?
The IUPAC name of methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate (CID 139183019) is methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate.
What is the SMILES notation for methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate?
The canonical SMILES for methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate is COC(=O)c1cncc(/C=C/C(F)(F)F)c1.COC(=O)c1cncc(/C=C/C(F)(F)F)c1.COC(=O)c1cncc(/C=C/C(F)(F)F)c1.
What is the InChIKey of methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate?
The InChIKey is NZERSVCCJNWHKD-FDRFSGEISA-N. The full InChI is InChI=1S/3C10H8F3NO2/c3*1-16-9(15)8-4-7(5-14-6-8)2-3-10(11,12)13/h3*2-6H,1H3/b3*3-2+.
What are the key properties of methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate?
methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate has a molecular weight of 693.52 g/mol, XLogP of 7.33, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(E)-3,3,3-trifluoroprop-1-enyl]pyridine-3-carboxylate is sourced from PubChem (CID 139183019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).